C14H21N3O6S — CID 108864331
3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]benzenesulfonic acid (PubChem CID 108864331) has the molecular formula C14H21N3O6S and a molecular weight of 359.40 g/mol. Its IUPAC name is 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]benzenesulfonic acid.
| Compound Name | 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108864331 |
| Molecular Formula | C14H21N3O6S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoylamino]benzenesulfonic acid |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H21N3O6S/c1-14(2,3)23-13(19)16-8-7-15-12(18)17-10-5-4-6-11(9-10)24(20,21)22/h4-6,9H,7-8H2,1-3H3,(H,16,19)(H2,15,17,18)(H,20,21,22) |
| InChIKey | KZKPLUBKXVQFOZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|