C24H31N3O6 — CID 122455545
methyl 2-hydroxy-2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylcarbamoylamino]phenyl]-2-phenylacetate (PubChem CID 122455545) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylcarbamoylamino]phenyl]-2-phenylacetate.
| Compound Name | methyl 2-hydroxy-2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylcarbamoylamino]phenyl]-2-phenylacetate |
|---|---|
| PubChem CID | 122455545 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | methyl 2-hydroxy-2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylcarbamoylamino]phenyl]-2-phenylacetate |
| SMILES | COC(=O)C(O)(c1ccccc1)c1cccc(NC(=O)NCCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C24H31N3O6/c1-23(2,3)33-22(30)26-15-9-14-25-21(29)27-19-13-8-12-18(16-19)24(31,20(28)32-4)17-10-6-5-7-11-17/h5-8,10-13,16,31H,9,14-15H2,1-4H3,(H,26,30)(H2,25,27,29) |
| InChIKey | DDOSDYQECISKGN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|