C23H31N3O5S — CID 52511775
tert-butyl N-[2-[[3-[[(2R)-2-phenylbutanoyl]amino]phenyl]sulfonylamino]ethyl]carbamate (PubChem CID 52511775) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[[(2R)-2-phenylbutanoyl]amino]phenyl]sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[[(2R)-2-phenylbutanoyl]amino]phenyl]sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 52511775 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | tert-butyl N-[2-[[3-[[(2R)-2-phenylbutanoyl]amino]phenyl]sulfonylamino]ethyl]carbamate |
| SMILES | CC[C@@H](C(=O)Nc1cccc(S(=O)(=O)NCCNC(=O)OC(C)(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O5S/c1-5-20(17-10-7-6-8-11-17)21(27)26-18-12-9-13-19(16-18)32(29,30)25-15-14-24-22(28)31-23(2,3)4/h6-13,16,20,25H,5,14-15H2,1-4H3,(H,24,28)(H,26,27)/t20-/m1/s1 |
| InChIKey | WRXIRBMYCSVJHV-HXUWFJFHSA-N |
| XLogP | 3.62 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|