C10H14N2O5S2 — CID 54774362
1-(benzenesulfonyl)-3-(2-methylsulfonylethyl)urea (PubChem CID 54774362) has the molecular formula C10H14N2O5S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(2-methylsulfonylethyl)urea.
| Compound Name | 1-(benzenesulfonyl)-3-(2-methylsulfonylethyl)urea |
|---|---|
| PubChem CID | 54774362 |
| Molecular Formula | C10H14N2O5S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(2-methylsulfonylethyl)urea |
| SMILES | CS(=O)(=O)CCNC(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H14N2O5S2/c1-18(14,15)8-7-11-10(13)12-19(16,17)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H2,11,12,13) |
| InChIKey | XKYFCISXHWJYRY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |