C12H15Br2NO2S — CID 106367478
4-bromo-N-[2-(bromomethyl)cyclopentyl]benzenesulfonamide (PubChem CID 106367478) has the molecular formula C12H15Br2NO2S and a molecular weight of 397.13 g/mol. Its IUPAC name is 4-bromo-N-[2-(bromomethyl)cyclopentyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(bromomethyl)cyclopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106367478 |
| Molecular Formula | C12H15Br2NO2S |
| Molecular Weight | 397.13 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 4-bromo-N-[2-(bromomethyl)cyclopentyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCC1CBr)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H15Br2NO2S/c13-8-9-2-1-3-12(9)15-18(16,17)11-6-4-10(14)5-7-11/h4-7,9,12,15H,1-3,8H2 |
| InChIKey | NGBYYWMGZAFYCO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|