C9H14BrN3O2S — CID 106367494
N-[2-(bromomethyl)cyclopentyl]-1H-pyrazole-5-sulfonamide (PubChem CID 106367494) has the molecular formula C9H14BrN3O2S and a molecular weight of 308.20 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclopentyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[2-(bromomethyl)cyclopentyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106367494 |
| Molecular Formula | C9H14BrN3O2S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | N-[2-(bromomethyl)cyclopentyl]-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1CBr)c1ccn[nH]1 |
| InChI | InChI=1S/C9H14BrN3O2S/c10-6-7-2-1-3-8(7)13-16(14,15)9-4-5-11-12-9/h4-5,7-8,13H,1-3,6H2,(H,11,12) |
| InChIKey | KFWGWZCOWRFTTH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|