C9H15N3O3S — CID 102739144
N-[(1S,2S)-2-hydroxycyclohexyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102739144) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102739144 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCC[C@@H]1O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H15N3O3S/c13-8-4-2-1-3-7(8)12-16(14,15)9-5-6-10-11-9/h5-8,12-13H,1-4H2,(H,10,11)/t7-,8-/m0/s1 |
| InChIKey | GYUFGEMVJZHDBZ-YUMQZZPRSA-N |
| XLogP | -0.01 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |