C18H20ClN3O4 — CID 55816186
methyl 2-[[3-[(5-chloro-2-pyridinyl)carbamoyl]piperidin-1-yl]methyl]furan-3-carboxylate (PubChem CID 55816186) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is methyl 2-[[3-[(5-chloro-2-pyridinyl)carbamoyl]piperidin-1-yl]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-[[3-[(5-chloro-2-pyridinyl)carbamoyl]piperidin-1-yl]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 55816186 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | methyl 2-[[3-[(5-chloro-2-pyridinyl)carbamoyl]piperidin-1-yl]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1CN1CCCC(C(=O)Nc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C18H20ClN3O4/c1-25-18(24)14-6-8-26-15(14)11-22-7-2-3-12(10-22)17(23)21-16-5-4-13(19)9-20-16/h4-6,8-9,12H,2-3,7,10-11H2,1H3,(H,20,21,23) |
| InChIKey | LEOWMVAXXZWOGO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |