C17H18Cl2N4O — CID 55816155
N-(5-chloro-2-pyridinyl)-1-[(6-chloro-3-pyridinyl)methyl]piperidine-3-carboxamide (PubChem CID 55816155) has the molecular formula C17H18Cl2N4O and a molecular weight of 365.26 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-[(6-chloro-3-pyridinyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-[(6-chloro-3-pyridinyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55816155 |
| Molecular Formula | C17H18Cl2N4O |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-[(6-chloro-3-pyridinyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C1CCCN(Cc2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C17H18Cl2N4O/c18-14-4-6-16(21-9-14)22-17(24)13-2-1-7-23(11-13)10-12-3-5-15(19)20-8-12/h3-6,8-9,13H,1-2,7,10-11H2,(H,21,22,24) |
| InChIKey | MMSPYHHZDMRDOF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|