C15H19ClN6OS — CID 55860839
N-(5-chloro-2-pyridinyl)-1-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidine-3-carboxamide (PubChem CID 55860839) has the molecular formula C15H19ClN6OS and a molecular weight of 366.88 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55860839 |
| Molecular Formula | C15H19ClN6OS |
| Molecular Weight | 366.88 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-[(4-methyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidine-3-carboxamide |
| SMILES | Cn1cnn(CN2CCCC(C(=O)Nc3ccc(Cl)cn3)C2)c1=S |
| InChI | InChI=1S/C15H19ClN6OS/c1-20-9-18-22(15(20)24)10-21-6-2-3-11(8-21)14(23)19-13-5-4-12(16)7-17-13/h4-5,7,9,11H,2-3,6,8,10H2,1H3,(H,17,19,23) |
| InChIKey | ZWLUROYFBLYMSF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.88 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|