C20H22ClFN4O2 — CID 56525461
N-(5-chloro-2-pyridinyl)-1-[3-(2-fluoroanilino)-3-oxopropyl]piperidine-3-carboxamide (PubChem CID 56525461) has the molecular formula C20H22ClFN4O2 and a molecular weight of 404.87 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-[3-(2-fluoroanilino)-3-oxopropyl]piperidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-[3-(2-fluoroanilino)-3-oxopropyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56525461 |
| Molecular Formula | C20H22ClFN4O2 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-[3-(2-fluoroanilino)-3-oxopropyl]piperidine-3-carboxamide |
| SMILES | O=C(CCN1CCCC(C(=O)Nc2ccc(Cl)cn2)C1)Nc1ccccc1F |
| InChI | InChI=1S/C20H22ClFN4O2/c21-15-7-8-18(23-12-15)25-20(28)14-4-3-10-26(13-14)11-9-19(27)24-17-6-2-1-5-16(17)22/h1-2,5-8,12,14H,3-4,9-11,13H2,(H,24,27)(H,23,25,28) |
| InChIKey | ZXBMZAUJWJIJKX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |