C16H21FN2O5 — CID 171154607
N-(2-fluorophenyl)-3-piperidin-1-ylpropanamide;oxalic acid (PubChem CID 171154607) has the molecular formula C16H21FN2O5 and a molecular weight of 340.35 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-piperidin-1-ylpropanamide;oxalic acid.
| Compound Name | N-(2-fluorophenyl)-3-piperidin-1-ylpropanamide;oxalic acid |
|---|---|
| PubChem CID | 171154607 |
| Molecular Formula | C16H21FN2O5 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(2-fluorophenyl)-3-piperidin-1-ylpropanamide;oxalic acid |
| SMILES | O=C(CCN1CCCCC1)Nc1ccccc1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H19FN2O.C2H2O4/c15-12-6-2-3-7-13(12)16-14(18)8-11-17-9-4-1-5-10-17;3-1(4)2(5)6/h2-3,6-7H,1,4-5,8-11H2,(H,16,18);(H,3,4)(H,5,6) |
| InChIKey | DYLUMBZUNPTMNC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|