C13H17FN2OS — CID 91843372
N-(2-fluorophenyl)-3-thiomorpholin-4-ylpropanamide (PubChem CID 91843372) has the molecular formula C13H17FN2OS and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-thiomorpholin-4-ylpropanamide.
| Compound Name | N-(2-fluorophenyl)-3-thiomorpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 91843372 |
| Molecular Formula | C13H17FN2OS |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(2-fluorophenyl)-3-thiomorpholin-4-ylpropanamide |
| SMILES | O=C(CCN1CCSCC1)Nc1ccccc1F |
| InChI | InChI=1S/C13H17FN2OS/c14-11-3-1-2-4-12(11)15-13(17)5-6-16-7-9-18-10-8-16/h1-4H,5-10H2,(H,15,17) |
| InChIKey | VOKFXHBQZNYLKE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |