C15H21ClFN3O — CID 120663779
3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-(2-fluorophenyl)propanamide;hydrochloride (PubChem CID 120663779) has the molecular formula C15H21ClFN3O and a molecular weight of 313.80 g/mol. Its IUPAC name is 3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-(2-fluorophenyl)propanamide;hydrochloride.
| Compound Name | 3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-(2-fluorophenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120663779 |
| Molecular Formula | C15H21ClFN3O |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-(2-fluorophenyl)propanamide;hydrochloride |
| SMILES | Cl.O=C(CCN1C[C@H]2CNC[C@H]2C1)Nc1ccccc1F |
| InChI | InChI=1S/C15H20FN3O.ClH/c16-13-3-1-2-4-14(13)18-15(20)5-6-19-9-11-7-17-8-12(11)10-19;/h1-4,11-12,17H,5-10H2,(H,18,20);1H/t11-,12+; |
| InChIKey | RZVYKXPXUBUHRT-IWKKHLOMSA-N |
| XLogP | 1.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |