C19H19ClN6OS — CID 55861104
N-(5-chloro-2-pyridinyl)-1-[(4-sulfanylidene-1,2,3-benzotriazin-3-yl)methyl]piperidine-3-carboxamide (PubChem CID 55861104) has the molecular formula C19H19ClN6OS and a molecular weight of 414.92 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-[(4-sulfanylidene-1,2,3-benzotriazin-3-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-[(4-sulfanylidene-1,2,3-benzotriazin-3-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55861104 |
| Molecular Formula | C19H19ClN6OS |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-[(4-sulfanylidene-1,2,3-benzotriazin-3-yl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C1CCCN(Cn2nnc3ccccc3c2=S)C1 |
| InChI | InChI=1S/C19H19ClN6OS/c20-14-7-8-17(21-10-14)22-18(27)13-4-3-9-25(11-13)12-26-19(28)15-5-1-2-6-16(15)23-24-26/h1-2,5-8,10,13H,3-4,9,11-12H2,(H,21,22,27) |
| InChIKey | QIVZHSVLRMLPNA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|