C17H24ClN7O — CID 55995286
1-[(1-butyltetrazol-5-yl)methyl]-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 55995286) has the molecular formula C17H24ClN7O and a molecular weight of 377.88 g/mol. Its IUPAC name is 1-[(1-butyltetrazol-5-yl)methyl]-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-[(1-butyltetrazol-5-yl)methyl]-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55995286 |
| Molecular Formula | C17H24ClN7O |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[(1-butyltetrazol-5-yl)methyl]-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | CCCCn1nnnc1CN1CCCC(C(=O)Nc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C17H24ClN7O/c1-2-3-9-25-16(21-22-23-25)12-24-8-4-5-13(11-24)17(26)20-15-7-6-14(18)10-19-15/h6-7,10,13H,2-5,8-9,11-12H2,1H3,(H,19,20,26) |
| InChIKey | UQACDMWVSPSQAB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |