C23H25N3O6S — CID 5309619
1-quinolin-8-ylsulfonyl-N-(3,4,5-trimethoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 5309619) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is 1-quinolin-8-ylsulfonyl-N-(3,4,5-trimethoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-quinolin-8-ylsulfonyl-N-(3,4,5-trimethoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 5309619 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 1-quinolin-8-ylsulfonyl-N-(3,4,5-trimethoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCCN2S(=O)(=O)c2cccc3cccnc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H25N3O6S/c1-30-18-13-16(14-19(31-2)22(18)32-3)25-23(27)17-9-6-12-26(17)33(28,29)20-10-4-7-15-8-5-11-24-21(15)20/h4-5,7-8,10-11,13-14,17H,6,9,12H2,1-3H3,(H,25,27) |
| InChIKey | RAJJMJDIKLMNLV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |