C21H19F2N3O3S — CID 20876148
N-(3,4-difluorophenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide (PubChem CID 20876148) has the molecular formula C21H19F2N3O3S and a molecular weight of 431.46 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 20876148 |
| Molecular Formula | C21H19F2N3O3S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-quinolin-8-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)C1CCCN(S(=O)(=O)c2cccc3cccnc23)C1 |
| InChI | InChI=1S/C21H19F2N3O3S/c22-17-9-8-16(12-18(17)23)25-21(27)15-6-3-11-26(13-15)30(28,29)19-7-1-4-14-5-2-10-24-20(14)19/h1-2,4-5,7-10,12,15H,3,6,11,13H2,(H,25,27) |
| InChIKey | MSGHCQHLAKQZFL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |