C12H18ClFN2O3S — CID 120708137
1-(4-fluoro-3-methoxyphenyl)sulfonyl-2-methylpiperazine;hydrochloride (PubChem CID 120708137) has the molecular formula C12H18ClFN2O3S and a molecular weight of 324.81 g/mol. Its IUPAC name is 1-(4-fluoro-3-methoxyphenyl)sulfonyl-2-methylpiperazine;hydrochloride.
| Compound Name | 1-(4-fluoro-3-methoxyphenyl)sulfonyl-2-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120708137 |
| Molecular Formula | C12H18ClFN2O3S |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-(4-fluoro-3-methoxyphenyl)sulfonyl-2-methylpiperazine;hydrochloride |
| SMILES | COc1cc(S(=O)(=O)N2CCNCC2C)ccc1F.Cl |
| InChI | InChI=1S/C12H17FN2O3S.ClH/c1-9-8-14-5-6-15(9)19(16,17)10-3-4-11(13)12(7-10)18-2;/h3-4,7,9,14H,5-6,8H2,1-2H3;1H |
| InChIKey | FXIVPICWWZZCTR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |