C18H17F3N2O4S2 — CID 26558722
1-thiophen-2-yl-4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]butane-1,4-dione (PubChem CID 26558722) has the molecular formula C18H17F3N2O4S2 and a molecular weight of 446.47 g/mol. Its IUPAC name is 1-thiophen-2-yl-4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]butane-1,4-dione.
| Compound Name | 1-thiophen-2-yl-4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 26558722 |
| Molecular Formula | C18H17F3N2O4S2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 1-thiophen-2-yl-4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1)c1cccs1 |
| InChI | InChI=1S/C18H17F3N2O4S2/c19-12-3-5-15(18(21)17(12)20)29(26,27)23-9-7-22(8-10-23)16(25)6-4-13(24)14-2-1-11-28-14/h1-3,5,11H,4,6-10H2 |
| InChIKey | DVXQJDCOHPREKD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|