C21H23F3N2O4S — CID 16552672
4-(3-methylphenoxy)-1-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 16552672) has the molecular formula C21H23F3N2O4S and a molecular weight of 456.49 g/mol. Its IUPAC name is 4-(3-methylphenoxy)-1-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-(3-methylphenoxy)-1-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 16552672 |
| Molecular Formula | C21H23F3N2O4S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 4-(3-methylphenoxy)-1-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | Cc1cccc(OCCCC(=O)N2CCN(S(=O)(=O)c3ccc(F)c(F)c3F)CC2)c1 |
| InChI | InChI=1S/C21H23F3N2O4S/c1-15-4-2-5-16(14-15)30-13-3-6-19(27)25-9-11-26(12-10-25)31(28,29)18-8-7-17(22)20(23)21(18)24/h2,4-5,7-8,14H,3,6,9-13H2,1H3 |
| InChIKey | GTMMBNXTAJVRRZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|