C23H30N2O5S — CID 108569120
1-[4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazin-1-yl]-4-phenoxybutan-1-one (PubChem CID 108569120) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is 1-[4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazin-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazin-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 108569120 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-[4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazin-1-yl]-4-phenoxybutan-1-one |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)N1CCN(C(=O)CCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O5S/c1-18-16-21(29-3)22(17-19(18)2)31(27,28)25-13-11-24(12-14-25)23(26)10-7-15-30-20-8-5-4-6-9-20/h4-6,8-9,16-17H,7,10-15H2,1-3H3 |
| InChIKey | ANGVQEXCNUKKCK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|