C17H26N2O4S — CID 110810028
1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-4-phenoxybutan-1-one (PubChem CID 110810028) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-4-phenoxybutan-1-one.
| Compound Name | 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 110810028 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-4-phenoxybutan-1-one |
| SMILES | CCS(=O)(=O)N1CCCN(C(=O)CCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C17H26N2O4S/c1-2-24(21,22)19-12-7-11-18(13-14-19)17(20)10-6-15-23-16-8-4-3-5-9-16/h3-5,8-9H,2,6-7,10-15H2,1H3 |
| InChIKey | JWKMFGYMHRQVAS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|