C27H38N2O3 — CID 108545354
1-[4-[2-(1-adamantyl)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one (PubChem CID 108545354) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 1-[4-[2-(1-adamantyl)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[4-[2-(1-adamantyl)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 108545354 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 1-[4-[2-(1-adamantyl)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1CCCN(C(=O)CC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C27H38N2O3/c30-25(8-4-13-32-24-6-2-1-3-7-24)28-9-5-10-29(12-11-28)26(31)20-27-17-21-14-22(18-27)16-23(15-21)19-27/h1-3,6-7,21-23H,4-5,8-20H2 |
| InChIKey | FJKBAQXCBXDZEI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|