C22H34N2O3 — CID 108545396
1-[4-[2-(1-adamantyl)acetyl]-1,4-diazepan-1-yl]pentane-1,4-dione (PubChem CID 108545396) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-[4-[2-(1-adamantyl)acetyl]-1,4-diazepan-1-yl]pentane-1,4-dione.
| Compound Name | 1-[4-[2-(1-adamantyl)acetyl]-1,4-diazepan-1-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 108545396 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-[4-[2-(1-adamantyl)acetyl]-1,4-diazepan-1-yl]pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)N1CCCN(C(=O)CC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C22H34N2O3/c1-16(25)3-4-20(26)23-5-2-6-24(8-7-23)21(27)15-22-12-17-9-18(13-22)11-19(10-17)14-22/h17-19H,2-15H2,1H3 |
| InChIKey | NHEFJVZJBLZHTC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |