C18H18F3N3O2S2 — CID 2442236
N-benzyl-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 2442236) has the molecular formula C18H18F3N3O2S2 and a molecular weight of 429.49 g/mol. Its IUPAC name is N-benzyl-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-benzyl-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2442236 |
| Molecular Formula | C18H18F3N3O2S2 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | N-benzyl-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1F)N1CCN(C(=S)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H18F3N3O2S2/c19-14-6-7-15(17(21)16(14)20)28(25,26)24-10-8-23(9-11-24)18(27)22-12-13-4-2-1-3-5-13/h1-7H,8-12H2,(H,22,27) |
| InChIKey | HKKARTJTFOQKHN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|