C23H24F3N3O4S — CID 55344220
1-(2-phenylethyl)-4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 55344220) has the molecular formula C23H24F3N3O4S and a molecular weight of 495.52 g/mol. Its IUPAC name is 1-(2-phenylethyl)-4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(2-phenylethyl)-4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 55344220 |
| Molecular Formula | C23H24F3N3O4S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 1-(2-phenylethyl)-4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCN(S(=O)(=O)c3ccc(F)c(F)c3F)CC2)CN1CCc1ccccc1 |
| InChI | InChI=1S/C23H24F3N3O4S/c24-18-6-7-19(22(26)21(18)25)34(32,33)29-12-10-27(11-13-29)23(31)17-14-20(30)28(15-17)9-8-16-4-2-1-3-5-16/h1-7,17H,8-15H2 |
| InChIKey | IDKFWTYQMORRMO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|