C20H23N3O7S2 — CID 55755643
[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-(4-propan-2-ylsulfonylphenyl)methanone (PubChem CID 55755643) has the molecular formula C20H23N3O7S2 and a molecular weight of 481.55 g/mol. Its IUPAC name is [4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-(4-propan-2-ylsulfonylphenyl)methanone.
| Compound Name | [4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-(4-propan-2-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 55755643 |
| Molecular Formula | C20H23N3O7S2 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | [4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-(4-propan-2-ylsulfonylphenyl)methanone |
| SMILES | CC(C)S(=O)(=O)c1ccc(C(=O)N2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H23N3O7S2/c1-15(2)31(27,28)17-9-7-16(8-10-17)20(24)21-11-13-22(14-12-21)32(29,30)19-6-4-3-5-18(19)23(25)26/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | QNZPKQPJCHPGLW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 134.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|