C15H19FN2O7S — CID 171154784
(4-ethylsulfonylpiperazin-1-yl)-(4-fluorophenyl)methanone;oxalic acid (PubChem CID 171154784) has the molecular formula C15H19FN2O7S and a molecular weight of 390.39 g/mol. Its IUPAC name is (4-ethylsulfonylpiperazin-1-yl)-(4-fluorophenyl)methanone;oxalic acid.
| Compound Name | (4-ethylsulfonylpiperazin-1-yl)-(4-fluorophenyl)methanone;oxalic acid |
|---|---|
| PubChem CID | 171154784 |
| Molecular Formula | C15H19FN2O7S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (4-ethylsulfonylpiperazin-1-yl)-(4-fluorophenyl)methanone;oxalic acid |
| SMILES | CCS(=O)(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H17FN2O3S.C2H2O4/c1-2-20(18,19)16-9-7-15(8-10-16)13(17)11-3-5-12(14)6-4-11;3-1(4)2(5)6/h3-6H,2,7-10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PFGPYNBIZSOXGV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|