C12H20N2O2S2 — CID 63874056
1-(2,5-dimethylthiophen-3-yl)sulfonyl-3,5-dimethylpiperazine (PubChem CID 63874056) has the molecular formula C12H20N2O2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)sulfonyl-3,5-dimethylpiperazine.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)sulfonyl-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 63874056 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)sulfonyl-3,5-dimethylpiperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CC(C)NC(C)C2)c(C)s1 |
| InChI | InChI=1S/C12H20N2O2S2/c1-8-6-14(7-9(2)13-8)18(15,16)12-5-10(3)17-11(12)4/h5,8-9,13H,6-7H2,1-4H3 |
| InChIKey | XRXXVNHXVQAYEN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |