C15H22BrFN2O2S — CID 120712618
5-bromo-4-fluoro-2-methyl-N-piperidin-4-yl-N-propylbenzenesulfonamide (PubChem CID 120712618) has the molecular formula C15H22BrFN2O2S and a molecular weight of 393.32 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2-methyl-N-piperidin-4-yl-N-propylbenzenesulfonamide.
| Compound Name | 5-bromo-4-fluoro-2-methyl-N-piperidin-4-yl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 120712618 |
| Molecular Formula | C15H22BrFN2O2S |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 5-bromo-4-fluoro-2-methyl-N-piperidin-4-yl-N-propylbenzenesulfonamide |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)c1cc(Br)c(F)cc1C |
| InChI | InChI=1S/C15H22BrFN2O2S/c1-3-8-19(12-4-6-18-7-5-12)22(20,21)15-10-13(16)14(17)9-11(15)2/h9-10,12,18H,3-8H2,1-2H3 |
| InChIKey | KPFWGGAFEIKJOG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |