C12H21N3O2S2 — CID 103951467
2-methyl-N-piperidin-4-yl-N-propyl-1,3-thiazole-5-sulfonamide (PubChem CID 103951467) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-methyl-N-piperidin-4-yl-N-propyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-methyl-N-piperidin-4-yl-N-propyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103951467 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-methyl-N-piperidin-4-yl-N-propyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-3-8-15(11-4-6-13-7-5-11)19(16,17)12-9-14-10(2)18-12/h9,11,13H,3-8H2,1-2H3 |
| InChIKey | WOBVVYHFVFSNRW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |