C14H23N3O4S2 — CID 175760574
4-N-piperidin-4-yl-4-N-propylbenzene-1,4-disulfonamide (PubChem CID 175760574) has the molecular formula C14H23N3O4S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-N-piperidin-4-yl-4-N-propylbenzene-1,4-disulfonamide.
| Compound Name | 4-N-piperidin-4-yl-4-N-propylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 175760574 |
| Molecular Formula | C14H23N3O4S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-N-piperidin-4-yl-4-N-propylbenzene-1,4-disulfonamide |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H23N3O4S2/c1-2-11-17(12-7-9-16-10-8-12)23(20,21)14-5-3-13(4-6-14)22(15,18)19/h3-6,12,16H,2,7-11H2,1H3,(H2,15,18,19) |
| InChIKey | LWOQALHFHKXUAQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |