C14H20F3N3O2S — CID 120712631
N-piperidin-4-yl-N-propyl-6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 120712631) has the molecular formula C14H20F3N3O2S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-piperidin-4-yl-N-propyl-6-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | N-piperidin-4-yl-N-propyl-6-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 120712631 |
| Molecular Formula | C14H20F3N3O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-piperidin-4-yl-N-propyl-6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H20F3N3O2S/c1-2-9-20(11-5-7-18-8-6-11)23(21,22)12-3-4-13(19-10-12)14(15,16)17/h3-4,10-11,18H,2,5-9H2,1H3 |
| InChIKey | DVQZFVBEUUBZJL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |