C13H22N2O2S2 — CID 54923399
5-methyl-N-piperidin-4-yl-N-propylthiophene-2-sulfonamide (PubChem CID 54923399) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 5-methyl-N-piperidin-4-yl-N-propylthiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-piperidin-4-yl-N-propylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54923399 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 5-methyl-N-piperidin-4-yl-N-propylthiophene-2-sulfonamide |
| SMILES | CCCN(C1CCNCC1)S(=O)(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-3-10-15(12-6-8-14-9-7-12)19(16,17)13-5-4-11(2)18-13/h4-5,12,14H,3,6-10H2,1-2H3 |
| InChIKey | SCTXQHNRYWSKPA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |