C10H17N3O2S2 — CID 103415221
N-(azetidin-3-yl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide (PubChem CID 103415221) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is N-(azetidin-3-yl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(azetidin-3-yl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103415221 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-(azetidin-3-yl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCCN(C1CNC1)S(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C10H17N3O2S2/c1-3-4-13(9-5-11-6-9)17(14,15)10-7-12-8(2)16-10/h7,9,11H,3-6H2,1-2H3 |
| InChIKey | DXQCIXIUVDOGTP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |