C11H16ClNO4S2 — CID 103099828
5-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 103099828) has the molecular formula C11H16ClNO4S2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 5-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 5-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 103099828 |
| Molecular Formula | C11H16ClNO4S2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | Cc1cc(S(=O)(=O)NCC(C)CCC(=O)O)sc1Cl |
| InChI | InChI=1S/C11H16ClNO4S2/c1-7(3-4-9(14)15)6-13-19(16,17)10-5-8(2)11(12)18-10/h5,7,13H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | AVZOKQWRNXPMHF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |