C11H17ClN2O2S2 — CID 103100511
N-(1-amino-2-cyclopropylpropan-2-yl)-5-chloro-4-methylthiophene-2-sulfonamide (PubChem CID 103100511) has the molecular formula C11H17ClN2O2S2 and a molecular weight of 308.86 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-5-chloro-4-methylthiophene-2-sulfonamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-5-chloro-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103100511 |
| Molecular Formula | C11H17ClN2O2S2 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-5-chloro-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)(CN)C2CC2)sc1Cl |
| InChI | InChI=1S/C11H17ClN2O2S2/c1-7-5-9(17-10(7)12)18(15,16)14-11(2,6-13)8-3-4-8/h5,8,14H,3-4,6,13H2,1-2H3 |
| InChIKey | QHCPZTXRDKXOCY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |