C15H24ClN3O3S2 — CID 119046095
N-tert-butyl-4-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]piperidine-1-carboxamide (PubChem CID 119046095) has the molecular formula C15H24ClN3O3S2 and a molecular weight of 393.96 g/mol. Its IUPAC name is N-tert-butyl-4-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]piperidine-1-carboxamide.
| Compound Name | N-tert-butyl-4-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 119046095 |
| Molecular Formula | C15H24ClN3O3S2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-tert-butyl-4-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]piperidine-1-carboxamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCN(C(=O)NC(C)(C)C)CC2)sc1Cl |
| InChI | InChI=1S/C15H24ClN3O3S2/c1-10-9-12(23-13(10)16)24(21,22)18-11-5-7-19(8-6-11)14(20)17-15(2,3)4/h9,11,18H,5-8H2,1-4H3,(H,17,20) |
| InChIKey | CCDIRBWOLDMAFX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |