C12H17ClN2O4S2 — CID 124853544
ethyl (3R)-3-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]pyrrolidine-1-carboxylate (PubChem CID 124853544) has the molecular formula C12H17ClN2O4S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is ethyl (3R)-3-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]pyrrolidine-1-carboxylate.
| Compound Name | ethyl (3R)-3-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 124853544 |
| Molecular Formula | C12H17ClN2O4S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | ethyl (3R)-3-[(5-chloro-4-methylthiophen-2-yl)sulfonylamino]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@@H](NS(=O)(=O)c2cc(C)c(Cl)s2)C1 |
| InChI | InChI=1S/C12H17ClN2O4S2/c1-3-19-12(16)15-5-4-9(7-15)14-21(17,18)10-6-8(2)11(13)20-10/h6,9,14H,3-5,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | VYQSVZADJOJWRJ-SECBINFHSA-N |
| XLogP | 2.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |