C12H16N4O4S — CID 114613924
2-[(6-cyano-3-pyridinyl)sulfonylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 114613924) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[(6-cyano-3-pyridinyl)sulfonylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[(6-cyano-3-pyridinyl)sulfonylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 114613924 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-[(6-cyano-3-pyridinyl)sulfonylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)NS(=O)(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C12H16N4O4S/c1-9(12(17)14-5-6-20-2)16-21(18,19)11-4-3-10(7-13)15-8-11/h3-4,8-9,16H,5-6H2,1-2H3,(H,14,17) |
| InChIKey | SJJKONSDWFCEBO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|