C12H17N3O3S — CID 115753732
6-cyano-N-(1-hydroxy-4-methylpentan-2-yl)pyridine-3-sulfonamide (PubChem CID 115753732) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 6-cyano-N-(1-hydroxy-4-methylpentan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(1-hydroxy-4-methylpentan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115753732 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 6-cyano-N-(1-hydroxy-4-methylpentan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(C)CC(CO)NS(=O)(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C12H17N3O3S/c1-9(2)5-11(8-16)15-19(17,18)12-4-3-10(6-13)14-7-12/h3-4,7,9,11,15-16H,5,8H2,1-2H3 |
| InChIKey | LVISOKBARRLLAP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |