C13H22BrClN2O2S2 — CID 80577767
5-bromo-4-chloro-N-[5-(diethylamino)pentan-2-yl]thiophene-2-sulfonamide (PubChem CID 80577767) has the molecular formula C13H22BrClN2O2S2 and a molecular weight of 417.82 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-[5-(diethylamino)pentan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-[5-(diethylamino)pentan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80577767 |
| Molecular Formula | C13H22BrClN2O2S2 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 5-bromo-4-chloro-N-[5-(diethylamino)pentan-2-yl]thiophene-2-sulfonamide |
| SMILES | CCN(CC)CCCC(C)NS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C13H22BrClN2O2S2/c1-4-17(5-2)8-6-7-10(3)16-21(18,19)12-9-11(15)13(14)20-12/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | FPNBSOANVRAONX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |