C13H13BrClNO3S2 — CID 80578862
5-bromo-4-chloro-N-(3-phenoxypropyl)thiophene-2-sulfonamide (PubChem CID 80578862) has the molecular formula C13H13BrClNO3S2 and a molecular weight of 410.74 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(3-phenoxypropyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(3-phenoxypropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80578862 |
| Molecular Formula | C13H13BrClNO3S2 |
| Molecular Weight | 410.74 g/mol |
| Exact Mass | 408.92 |
| IUPAC Name | 5-bromo-4-chloro-N-(3-phenoxypropyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCOc1ccccc1)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C13H13BrClNO3S2/c14-13-11(15)9-12(20-13)21(17,18)16-7-4-8-19-10-5-2-1-3-6-10/h1-3,5-6,9,16H,4,7-8H2 |
| InChIKey | ZGAPHBCNFDFGFA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|