C9H9BrClNO2S2 — CID 116645089
5-bromo-4-chloro-N-pent-3-ynylthiophene-2-sulfonamide (PubChem CID 116645089) has the molecular formula C9H9BrClNO2S2 and a molecular weight of 342.67 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-pent-3-ynylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-pent-3-ynylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 116645089 |
| Molecular Formula | C9H9BrClNO2S2 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 340.89 |
| IUPAC Name | 5-bromo-4-chloro-N-pent-3-ynylthiophene-2-sulfonamide |
| SMILES | CC#CCCNS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C9H9BrClNO2S2/c1-2-3-4-5-12-16(13,14)8-6-7(11)9(10)15-8/h6,12H,4-5H2,1H3 |
| InChIKey | GBDWHILKIHBTLT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|