C9H13BrClNO3S2 — CID 80578090
5-bromo-4-chloro-N-(2-hydroxy-2-methylbutyl)thiophene-2-sulfonamide (PubChem CID 80578090) has the molecular formula C9H13BrClNO3S2 and a molecular weight of 362.70 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(2-hydroxy-2-methylbutyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(2-hydroxy-2-methylbutyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80578090 |
| Molecular Formula | C9H13BrClNO3S2 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 360.92 |
| IUPAC Name | 5-bromo-4-chloro-N-(2-hydroxy-2-methylbutyl)thiophene-2-sulfonamide |
| SMILES | CCC(C)(O)CNS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C9H13BrClNO3S2/c1-3-9(2,13)5-12-17(14,15)7-4-6(11)8(10)16-7/h4,12-13H,3,5H2,1-2H3 |
| InChIKey | UZKLCDLVXBFQNE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |