C8H10N2O5S2 — CID 40634872
(2R)-2-[(5-carbamoylthiophen-3-yl)sulfonylamino]propanoic acid (PubChem CID 40634872) has the molecular formula C8H10N2O5S2 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2R)-2-[(5-carbamoylthiophen-3-yl)sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[(5-carbamoylthiophen-3-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 40634872 |
| Molecular Formula | C8H10N2O5S2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | (2R)-2-[(5-carbamoylthiophen-3-yl)sulfonylamino]propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)c1csc(C(N)=O)c1)C(=O)O |
| InChI | InChI=1S/C8H10N2O5S2/c1-4(8(12)13)10-17(14,15)5-2-6(7(9)11)16-3-5/h2-4,10H,1H3,(H2,9,11)(H,12,13)/t4-/m1/s1 |
| InChIKey | AWWKTCLRPBEGKA-SCSAIBSYSA-N |
| XLogP | -0.40 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |