C9H13NO6S2 — CID 106185920
4-[(1-hydroxy-3-methoxypropan-2-yl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 106185920) has the molecular formula C9H13NO6S2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[(1-hydroxy-3-methoxypropan-2-yl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(1-hydroxy-3-methoxypropan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106185920 |
| Molecular Formula | C9H13NO6S2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 4-[(1-hydroxy-3-methoxypropan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | COCC(CO)NS(=O)(=O)c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C9H13NO6S2/c1-16-4-6(3-11)10-18(14,15)7-2-8(9(12)13)17-5-7/h2,5-6,10-11H,3-4H2,1H3,(H,12,13) |
| InChIKey | HFBIMCUXWSMZDR-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |