C14H14N2O5S2 — CID 6504034
2-[[5-(phenylcarbamoyl)thiophen-3-yl]sulfonylamino]propanoic acid (PubChem CID 6504034) has the molecular formula C14H14N2O5S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[[5-(phenylcarbamoyl)thiophen-3-yl]sulfonylamino]propanoic acid.
| Compound Name | 2-[[5-(phenylcarbamoyl)thiophen-3-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 6504034 |
| Molecular Formula | C14H14N2O5S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2-[[5-(phenylcarbamoyl)thiophen-3-yl]sulfonylamino]propanoic acid |
| SMILES | CC(NS(=O)(=O)c1csc(C(=O)Nc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C14H14N2O5S2/c1-9(14(18)19)16-23(20,21)11-7-12(22-8-11)13(17)15-10-5-3-2-4-6-10/h2-9,16H,1H3,(H,15,17)(H,18,19) |
| InChIKey | AGGYNAOMOXGEGS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |