C12H14N2O2S3 — CID 106057752
5-(aminomethyl)-N-(4-methylsulfanylphenyl)thiophene-3-sulfonamide (PubChem CID 106057752) has the molecular formula C12H14N2O2S3 and a molecular weight of 314.46 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(4-methylsulfanylphenyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(4-methylsulfanylphenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106057752 |
| Molecular Formula | C12H14N2O2S3 |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 5-(aminomethyl)-N-(4-methylsulfanylphenyl)thiophene-3-sulfonamide |
| SMILES | CSc1ccc(NS(=O)(=O)c2csc(CN)c2)cc1 |
| InChI | InChI=1S/C12H14N2O2S3/c1-17-10-4-2-9(3-5-10)14-19(15,16)12-6-11(7-13)18-8-12/h2-6,8,14H,7,13H2,1H3 |
| InChIKey | ULUISMPSAYJXNM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |